C13H22O — CID 174803565
butan-1-ol;1,2,3-trimethylbenzene (PubChem CID 174803565) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is butan-1-ol;1,2,3-trimethylbenzene.
| Compound Name | butan-1-ol;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 174803565 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | butan-1-ol;1,2,3-trimethylbenzene |
| SMILES | CCCCO.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C4H10O/c1-7-5-4-6-8(2)9(7)3;1-2-3-4-5/h4-6H,1-3H3;5H,2-4H2,1H3 |
| InChIKey | HZTBQESEDHGGDM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |