C9H12ClK — CID 174813799
potassium;1,2,3-trimethylbenzene;chloride (PubChem CID 174813799) has the molecular formula C9H12ClK and a molecular weight of 194.75 g/mol. Its IUPAC name is potassium;1,2,3-trimethylbenzene;chloride.
| Compound Name | potassium;1,2,3-trimethylbenzene;chloride |
|---|---|
| PubChem CID | 174813799 |
| Molecular Formula | C9H12ClK |
| Molecular Weight | 194.75 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | potassium;1,2,3-trimethylbenzene;chloride |
| SMILES | Cc1cccc(C)c1C.[Cl-].[K+] |
| InChI | InChI=1S/C9H12.ClH.K/c1-7-5-4-6-8(2)9(7)3;;/h4-6H,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | XSKBYVNYXAJMEL-UHFFFAOYSA-M |
| XLogP | -3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.75 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |