C9H12Cl2Ru — CID 87163409
dichlororuthenium;1,2,3-trimethylbenzene (PubChem CID 87163409) has the molecular formula C9H12Cl2Ru and a molecular weight of 292.17 g/mol. Its IUPAC name is dichlororuthenium;1,2,3-trimethylbenzene.
| Compound Name | dichlororuthenium;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 87163409 |
| Molecular Formula | C9H12Cl2Ru |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | dichlororuthenium;1,2,3-trimethylbenzene |
| SMILES | Cc1cccc(C)c1C.Cl[Ru]Cl |
| InChI | InChI=1S/C9H12.2ClH.Ru/c1-7-5-4-6-8(2)9(7)3;;;/h4-6H,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | BTXZMEYUGZYFLX-UHFFFAOYSA-L |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |