C10H17N — CID 142025904
2,3-dimethylaniline;ethane (PubChem CID 142025904) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,3-dimethylaniline;ethane.
| Compound Name | 2,3-dimethylaniline;ethane |
|---|---|
| PubChem CID | 142025904 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,3-dimethylaniline;ethane |
| SMILES | CC.Cc1cccc(N)c1C |
| InChI | InChI=1S/C8H11N.C2H6/c1-6-4-3-5-8(9)7(6)2;1-2/h3-5H,9H2,1-2H3;1-2H3 |
| InChIKey | ATBRJLRFFDYSNF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|