C16H22N2 — CID 159444672
2,3-dimethylaniline;2,3,4-trideuterio-5-methyl-6-(trideuteriomethyl)aniline (PubChem CID 159444672) has the molecular formula C16H22N2 and a molecular weight of 248.40 g/mol. Its IUPAC name is 2,3-dimethylaniline;2,3,4-trideuterio-5-methyl-6-(trideuteriomethyl)aniline.
| Compound Name | 2,3-dimethylaniline;2,3,4-trideuterio-5-methyl-6-(trideuteriomethyl)aniline |
|---|---|
| PubChem CID | 159444672 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.22 |
| IUPAC Name | 2,3-dimethylaniline;2,3,4-trideuterio-5-methyl-6-(trideuteriomethyl)aniline |
| SMILES | Cc1cccc(N)c1C.[2H]c1c([2H])c(C)c(C([2H])([2H])[2H])c(N)c1[2H] |
| InChI | InChI=1S/2C8H11N/c2*1-6-4-3-5-8(9)7(6)2/h2*3-5H,9H2,1-2H3/i2D3,3D,4D,5D; |
| InChIKey | LSPPTVIZOAXLFC-WIESSRMXSA-N |
| XLogP | 3.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|