C7H10N2 — CID 71315901
3-(trideuteriomethyl)benzene-1,2-diamine (PubChem CID 71315901) has the molecular formula C7H10N2 and a molecular weight of 125.19 g/mol. Its IUPAC name is 3-(trideuteriomethyl)benzene-1,2-diamine.
| Compound Name | 3-(trideuteriomethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 71315901 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 3-(trideuteriomethyl)benzene-1,2-diamine |
| SMILES | [2H]C([2H])([2H])c1cccc(N)c1N |
| InChI | InChI=1S/C7H10N2/c1-5-3-2-4-6(8)7(5)9/h2-4H,8-9H2,1H3/i1D3 |
| InChIKey | AXNUJYHFQHQZBE-FIBGUPNXSA-N |
| XLogP | 1.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|