About methanol;3-methylbenzene-1,2-diamine
methanol;3-methylbenzene-1,2-diamine (PubChem CID 174839717) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is methanol;3-methylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | methanol;3-methylbenzene-1,2-diamine |
| PubChem CID | 174839717 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | methanol;3-methylbenzene-1,2-diamine |
| SMILES | CO.Cc1cccc(N)c1N |
| InChI | InChI=1S/C7H10N2.CH4O/c1-5-3-2-4-6(8)7(5)9;1-2/h2-4H,8-9H2,1H3;2H,1H3 |
| InChIKey | YTJWYTIYOJRLGT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methanol;3-methylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;3-methylbenzene-1,2-diamine?
The IUPAC name of methanol;3-methylbenzene-1,2-diamine (CID 174839717) is methanol;3-methylbenzene-1,2-diamine.
What is the SMILES notation for methanol;3-methylbenzene-1,2-diamine?
The canonical SMILES for methanol;3-methylbenzene-1,2-diamine is CO.Cc1cccc(N)c1N.
What is the InChIKey of methanol;3-methylbenzene-1,2-diamine?
The InChIKey is YTJWYTIYOJRLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.CH4O/c1-5-3-2-4-6(8)7(5)9;1-2/h2-4H,8-9H2,1H3;2H,1H3.
What are the key properties of methanol;3-methylbenzene-1,2-diamine?
methanol;3-methylbenzene-1,2-diamine has a molecular weight of 154.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;3-methylbenzene-1,2-diamine is sourced from PubChem (CID 174839717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).