About 2-methylaniline;dihydrochloride
2-methylaniline;dihydrochloride (PubChem CID 23331471) has the molecular formula C7H11Cl2N
and a molecular weight of 180.08 g/mol. Its IUPAC name is 2-methylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylaniline;dihydrochloride |
| PubChem CID | 23331471 |
| Molecular Formula | C7H11Cl2N |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-methylaniline;dihydrochloride |
| SMILES | Cc1ccccc1N.Cl.Cl |
| InChI | InChI=1S/C7H9N.2ClH/c1-6-4-2-3-5-7(6)8;;/h2-5H,8H2,1H3;2*1H |
| InChIKey | LTQUYHOGYCOTIT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;dihydrochloride?
The IUPAC name of 2-methylaniline;dihydrochloride (CID 23331471) is 2-methylaniline;dihydrochloride.
What is the SMILES notation for 2-methylaniline;dihydrochloride?
The canonical SMILES for 2-methylaniline;dihydrochloride is Cc1ccccc1N.Cl.Cl.
What is the InChIKey of 2-methylaniline;dihydrochloride?
The InChIKey is LTQUYHOGYCOTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2ClH/c1-6-4-2-3-5-7(6)8;;/h2-5H,8H2,1H3;2*1H.
What are the key properties of 2-methylaniline;dihydrochloride?
2-methylaniline;dihydrochloride has a molecular weight of 180.08 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;dihydrochloride is sourced from PubChem (CID 23331471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).