About acetaldehyde;ethane;2-methylaniline
acetaldehyde;ethane;2-methylaniline (PubChem CID 144857558) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is acetaldehyde;ethane;2-methylaniline.
Molecular Properties
| Compound Name | acetaldehyde;ethane;2-methylaniline |
| PubChem CID | 144857558 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | acetaldehyde;ethane;2-methylaniline |
| SMILES | CC.CC=O.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C2H4O.C2H6/c1-6-4-2-3-5-7(6)8;1-2-3;1-2/h2-5H,8H2,1H3;2H,1H3;1-2H3 |
| InChIKey | IIQUKIDIVVMBPY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;ethane;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;ethane;2-methylaniline?
The IUPAC name of acetaldehyde;ethane;2-methylaniline (CID 144857558) is acetaldehyde;ethane;2-methylaniline.
What is the SMILES notation for acetaldehyde;ethane;2-methylaniline?
The canonical SMILES for acetaldehyde;ethane;2-methylaniline is CC.CC=O.Cc1ccccc1N.
What is the InChIKey of acetaldehyde;ethane;2-methylaniline?
The InChIKey is IIQUKIDIVVMBPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H4O.C2H6/c1-6-4-2-3-5-7(6)8;1-2-3;1-2/h2-5H,8H2,1H3;2H,1H3;1-2H3.
What are the key properties of acetaldehyde;ethane;2-methylaniline?
acetaldehyde;ethane;2-methylaniline has a molecular weight of 181.28 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;ethane;2-methylaniline is sourced from PubChem (CID 144857558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).