About N,N-dimethylmethanamine;2-methylaniline
N,N-dimethylmethanamine;2-methylaniline (PubChem CID 174412120) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-methylaniline.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;2-methylaniline |
| PubChem CID | 174412120 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,N-dimethylmethanamine;2-methylaniline |
| SMILES | CN(C)C.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C3H9N/c1-6-4-2-3-5-7(6)8;1-4(2)3/h2-5H,8H2,1H3;1-3H3 |
| InChIKey | OGGRXNCZUKGBNH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;2-methylaniline?
The IUPAC name of N,N-dimethylmethanamine;2-methylaniline (CID 174412120) is N,N-dimethylmethanamine;2-methylaniline.
What is the SMILES notation for N,N-dimethylmethanamine;2-methylaniline?
The canonical SMILES for N,N-dimethylmethanamine;2-methylaniline is CN(C)C.Cc1ccccc1N.
What is the InChIKey of N,N-dimethylmethanamine;2-methylaniline?
The InChIKey is OGGRXNCZUKGBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C3H9N/c1-6-4-2-3-5-7(6)8;1-4(2)3/h2-5H,8H2,1H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;2-methylaniline?
N,N-dimethylmethanamine;2-methylaniline has a molecular weight of 166.27 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;2-methylaniline is sourced from PubChem (CID 174412120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).