About deuteriomethane;2-methylaniline
deuteriomethane;2-methylaniline (PubChem CID 90744870) has the molecular formula C8H13N
and a molecular weight of 124.21 g/mol. Its IUPAC name is deuteriomethane;2-methylaniline.
Molecular Properties
| Compound Name | deuteriomethane;2-methylaniline |
| PubChem CID | 90744870 |
| Molecular Formula | C8H13N |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | deuteriomethane;2-methylaniline |
| SMILES | Cc1ccccc1N.[2H]C |
| InChI | InChI=1S/C7H9N.CH4/c1-6-4-2-3-5-7(6)8;/h2-5H,8H2,1H3;1H4/i;1D |
| InChIKey | ASMRHVZQBZWYAD-DIYDOPDJSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethane;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;2-methylaniline?
The IUPAC name of deuteriomethane;2-methylaniline (CID 90744870) is deuteriomethane;2-methylaniline.
What is the SMILES notation for deuteriomethane;2-methylaniline?
The canonical SMILES for deuteriomethane;2-methylaniline is Cc1ccccc1N.[2H]C.
What is the InChIKey of deuteriomethane;2-methylaniline?
The InChIKey is ASMRHVZQBZWYAD-DIYDOPDJSA-N. The full InChI is InChI=1S/C7H9N.CH4/c1-6-4-2-3-5-7(6)8;/h2-5H,8H2,1H3;1H4/i;1D.
What are the key properties of deuteriomethane;2-methylaniline?
deuteriomethane;2-methylaniline has a molecular weight of 124.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;2-methylaniline is sourced from PubChem (CID 90744870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).