About ethane;2-methylaniline;propane
ethane;2-methylaniline;propane (PubChem CID 144801075) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is ethane;2-methylaniline;propane.
Molecular Properties
| Compound Name | ethane;2-methylaniline;propane |
| PubChem CID | 144801075 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | ethane;2-methylaniline;propane |
| SMILES | CC.CCC.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C3H8.C2H6/c1-6-4-2-3-5-7(6)8;1-3-2;1-2/h2-5H,8H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | SNLCHCMUOBLOFZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylaniline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylaniline;propane?
The IUPAC name of ethane;2-methylaniline;propane (CID 144801075) is ethane;2-methylaniline;propane.
What is the SMILES notation for ethane;2-methylaniline;propane?
The canonical SMILES for ethane;2-methylaniline;propane is CC.CCC.Cc1ccccc1N.
What is the InChIKey of ethane;2-methylaniline;propane?
The InChIKey is SNLCHCMUOBLOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C3H8.C2H6/c1-6-4-2-3-5-7(6)8;1-3-2;1-2/h2-5H,8H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methylaniline;propane?
ethane;2-methylaniline;propane has a molecular weight of 181.32 g/mol, XLogP of 4.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylaniline;propane is sourced from PubChem (CID 144801075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).