About ethane;methanamine;2-methylaniline
ethane;methanamine;2-methylaniline (PubChem CID 91356397) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;methanamine;2-methylaniline.
Molecular Properties
| Compound Name | ethane;methanamine;2-methylaniline |
| PubChem CID | 91356397 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | ethane;methanamine;2-methylaniline |
| SMILES | CC.CC.CN.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.2C2H6.CH5N/c1-6-4-2-3-5-7(6)8;3*1-2/h2-5H,8H2,1H3;2*1-2H3;2H2,1H3 |
| InChIKey | HPTYYDDECMADFZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanamine;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;2-methylaniline?
The IUPAC name of ethane;methanamine;2-methylaniline (CID 91356397) is ethane;methanamine;2-methylaniline.
What is the SMILES notation for ethane;methanamine;2-methylaniline?
The canonical SMILES for ethane;methanamine;2-methylaniline is CC.CC.CN.Cc1ccccc1N.
What is the InChIKey of ethane;methanamine;2-methylaniline?
The InChIKey is HPTYYDDECMADFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2C2H6.CH5N/c1-6-4-2-3-5-7(6)8;3*1-2/h2-5H,8H2,1H3;2*1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;2-methylaniline?
ethane;methanamine;2-methylaniline has a molecular weight of 198.35 g/mol, XLogP of 3.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;2-methylaniline is sourced from PubChem (CID 91356397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).