About 2,6-dimethylaniline;2-methylaniline
2,6-dimethylaniline;2-methylaniline (PubChem CID 160714609) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,6-dimethylaniline;2-methylaniline.
Molecular Properties
| Compound Name | 2,6-dimethylaniline;2-methylaniline |
| PubChem CID | 160714609 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,6-dimethylaniline;2-methylaniline |
| SMILES | Cc1cccc(C)c1N.Cc1ccccc1N |
| InChI | InChI=1S/C8H11N.C7H9N/c1-6-4-3-5-7(2)8(6)9;1-6-4-2-3-5-7(6)8/h3-5H,9H2,1-2H3;2-5H,8H2,1H3 |
| InChIKey | RSHOJSKRTWVQLH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylaniline;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylaniline;2-methylaniline?
The IUPAC name of 2,6-dimethylaniline;2-methylaniline (CID 160714609) is 2,6-dimethylaniline;2-methylaniline.
What is the SMILES notation for 2,6-dimethylaniline;2-methylaniline?
The canonical SMILES for 2,6-dimethylaniline;2-methylaniline is Cc1cccc(C)c1N.Cc1ccccc1N.
What is the InChIKey of 2,6-dimethylaniline;2-methylaniline?
The InChIKey is RSHOJSKRTWVQLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C7H9N/c1-6-4-3-5-7(2)8(6)9;1-6-4-2-3-5-7(6)8/h3-5H,9H2,1-2H3;2-5H,8H2,1H3.
What are the key properties of 2,6-dimethylaniline;2-methylaniline?
2,6-dimethylaniline;2-methylaniline has a molecular weight of 228.34 g/mol, XLogP of 3.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylaniline;2-methylaniline is sourced from PubChem (CID 160714609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).