C23H29N — CID 159970542
2-methylaniline;1,3-xylene;1,4-xylene (PubChem CID 159970542) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-methylaniline;1,3-xylene;1,4-xylene.
| Compound Name | 2-methylaniline;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 159970542 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-methylaniline;1,3-xylene;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1cccc(C)c1.Cc1ccccc1N |
| InChI | InChI=1S/2C8H10.C7H9N/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-6-4-2-3-5-7(6)8/h2*3-6H,1-2H3;2-5H,8H2,1H3 |
| InChIKey | OEMKBASEIYKZFK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|