C20H20N2 — CID 162465787
2-N-[2-[2,6-bis(trideuteriomethyl)phenyl]phenyl]benzene-1,2-diamine (PubChem CID 162465787) has the molecular formula C20H20N2 and a molecular weight of 294.43 g/mol. Its IUPAC name is 2-N-[2-[2,6-bis(trideuteriomethyl)phenyl]phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-[2,6-bis(trideuteriomethyl)phenyl]phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 162465787 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-N-[2-[2,6-bis(trideuteriomethyl)phenyl]phenyl]benzene-1,2-diamine |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1ccccc1Nc1ccccc1N |
| InChI | InChI=1S/C20H20N2/c1-14-8-7-9-15(2)20(14)16-10-3-5-12-18(16)22-19-13-6-4-11-17(19)21/h3-13,22H,21H2,1-2H3/i1D3,2D3 |
| InChIKey | PSXJEFBEOSESLU-WFGJKAKNSA-N |
| XLogP | 5.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|