C8H11NO3S — CID 174311736
2,3-dimethylaniline;sulfur trioxide (PubChem CID 174311736) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2,3-dimethylaniline;sulfur trioxide.
| Compound Name | 2,3-dimethylaniline;sulfur trioxide |
|---|---|
| PubChem CID | 174311736 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2,3-dimethylaniline;sulfur trioxide |
| SMILES | Cc1cccc(N)c1C.O=S(=O)=O |
| InChI | InChI=1S/C8H11N.O3S/c1-6-4-3-5-8(9)7(6)2;1-4(2)3/h3-5H,9H2,1-2H3; |
| InChIKey | CPQFTMSNYMNJGK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|