C11H18OS — CID 174947389
methylsulfinylmethane;1,2,3-trimethylbenzene (PubChem CID 174947389) has the molecular formula C11H18OS and a molecular weight of 198.33 g/mol. Its IUPAC name is methylsulfinylmethane;1,2,3-trimethylbenzene.
| Compound Name | methylsulfinylmethane;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 174947389 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | methylsulfinylmethane;1,2,3-trimethylbenzene |
| SMILES | CS(C)=O.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C2H6OS/c1-7-5-4-6-8(2)9(7)3;1-4(2)3/h4-6H,1-3H3;1-2H3 |
| InChIKey | KFMXIBPRMXSVIM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |