C24H27OP — CID 118862460
1-bis(2,3-dimethylphenyl)phosphoryl-2,3-dimethylbenzene (PubChem CID 118862460) has the molecular formula C24H27OP and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-bis(2,3-dimethylphenyl)phosphoryl-2,3-dimethylbenzene.
| Compound Name | 1-bis(2,3-dimethylphenyl)phosphoryl-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 118862460 |
| Molecular Formula | C24H27OP |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-bis(2,3-dimethylphenyl)phosphoryl-2,3-dimethylbenzene |
| SMILES | Cc1cccc(P(=O)(c2cccc(C)c2C)c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C24H27OP/c1-16-10-7-13-22(19(16)4)26(25,23-14-8-11-17(2)20(23)5)24-15-9-12-18(3)21(24)6/h7-15H,1-6H3 |
| InChIKey | DPHWISCWRQKJHX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|