C16H23O2PSi2 — CID 173270331
bis[(2,3-dimethylphenyl)silyl]phosphinic acid (PubChem CID 173270331) has the molecular formula C16H23O2PSi2 and a molecular weight of 334.50 g/mol. Its IUPAC name is bis[(2,3-dimethylphenyl)silyl]phosphinic acid.
| Compound Name | bis[(2,3-dimethylphenyl)silyl]phosphinic acid |
|---|---|
| PubChem CID | 173270331 |
| Molecular Formula | C16H23O2PSi2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | bis[(2,3-dimethylphenyl)silyl]phosphinic acid |
| SMILES | Cc1cccc([SiH2]P(=O)(O)[SiH2]c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C16H23O2PSi2/c1-11-7-5-9-15(13(11)3)20-19(17,18)21-16-10-6-8-12(2)14(16)4/h5-10H,20-21H2,1-4H3,(H,17,18) |
| InChIKey | XLKHLTUOHKRASO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|