C18H26 — CID 157250417
methane;1,2,3-trimethylbenzene;1,2-xylene (PubChem CID 157250417) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is methane;1,2,3-trimethylbenzene;1,2-xylene.
| Compound Name | methane;1,2,3-trimethylbenzene;1,2-xylene |
|---|---|
| PubChem CID | 157250417 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | methane;1,2,3-trimethylbenzene;1,2-xylene |
| SMILES | C.Cc1cccc(C)c1C.Cc1ccccc1C |
| InChI | InChI=1S/C9H12.C8H10.CH4/c1-7-5-4-6-8(2)9(7)3;1-7-5-3-4-6-8(7)2;/h4-6H,1-3H3;3-6H,1-2H3;1H4 |
| InChIKey | AWGTTXZEGXYZGX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |