C18H26Si2 — CID 173345555
(2,3-dimethylphenyl)-[2-(2,3-dimethylphenyl)silylethyl]silane (PubChem CID 173345555) has the molecular formula C18H26Si2 and a molecular weight of 298.58 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-[2-(2,3-dimethylphenyl)silylethyl]silane.
| Compound Name | (2,3-dimethylphenyl)-[2-(2,3-dimethylphenyl)silylethyl]silane |
|---|---|
| PubChem CID | 173345555 |
| Molecular Formula | C18H26Si2 |
| Molecular Weight | 298.58 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2,3-dimethylphenyl)-[2-(2,3-dimethylphenyl)silylethyl]silane |
| SMILES | Cc1cccc([SiH2]CC[SiH2]c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C18H26Si2/c1-13-7-5-9-17(15(13)3)19-11-12-20-18-10-6-8-14(2)16(18)4/h5-10H,11-12,19-20H2,1-4H3 |
| InChIKey | VKIGFGNFWPWNRD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|