C24H32Si2 — CID 173345875
benzene;(2,3-dimethylphenyl)-[1-(2,3-dimethylphenyl)silylethyl]silane (PubChem CID 173345875) has the molecular formula C24H32Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is benzene;(2,3-dimethylphenyl)-[1-(2,3-dimethylphenyl)silylethyl]silane.
| Compound Name | benzene;(2,3-dimethylphenyl)-[1-(2,3-dimethylphenyl)silylethyl]silane |
|---|---|
| PubChem CID | 173345875 |
| Molecular Formula | C24H32Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | benzene;(2,3-dimethylphenyl)-[1-(2,3-dimethylphenyl)silylethyl]silane |
| SMILES | Cc1cccc([SiH2]C(C)[SiH2]c2cccc(C)c2C)c1C.c1ccccc1 |
| InChI | InChI=1S/C18H26Si2.C6H6/c1-12-8-6-10-17(14(12)3)19-16(5)20-18-11-7-9-13(2)15(18)4;1-2-4-6-5-3-1/h6-11,16H,19-20H2,1-5H3;1-6H |
| InChIKey | CEIQEONSHMEXAZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|