About 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine
1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine (PubChem CID 143062777) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine.
Analyze 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine?
The IUPAC name of 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine (CID 143062777) is 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine.
What is the SMILES notation for 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine?
The canonical SMILES for 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine is CNC.Cc1cccc(C(C)C)c1C.
What is the InChIKey of 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine?
The InChIKey is CGXFFKBIWFLXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C2H7N/c1-8(2)11-7-5-6-9(3)10(11)4;1-3-2/h5-8H,1-4H3;3H,1-2H3.
What are the key properties of 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine?
1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine has a molecular weight of 193.33 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-propan-2-ylbenzene;N-methylmethanamine is sourced from PubChem (CID 143062777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).