C11H16S — CID 86182436
1,2-dimethyl-3-(1-methylsulfanylethyl)benzene (PubChem CID 86182436) has the molecular formula C11H16S and a molecular weight of 180.32 g/mol. Its IUPAC name is 1,2-dimethyl-3-(1-methylsulfanylethyl)benzene.
| Compound Name | 1,2-dimethyl-3-(1-methylsulfanylethyl)benzene |
|---|---|
| PubChem CID | 86182436 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1,2-dimethyl-3-(1-methylsulfanylethyl)benzene |
| SMILES | CSC(C)c1cccc(C)c1C |
| InChI | InChI=1S/C11H16S/c1-8-6-5-7-11(9(8)2)10(3)12-4/h5-7,10H,1-4H3 |
| InChIKey | IVRDRAYGQDZSAV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |