C14H23N — CID 115850536
1-(2,3-dimethylphenyl)-2,3-dimethylbutan-1-amine (PubChem CID 115850536) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 1-(2,3-dimethylphenyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 115850536 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2,3-dimethylbutan-1-amine |
| SMILES | Cc1cccc(C(N)C(C)C(C)C)c1C |
| InChI | InChI=1S/C14H23N/c1-9(2)11(4)14(15)13-8-6-7-10(3)12(13)5/h6-9,11,14H,15H2,1-5H3 |
| InChIKey | PUBPZYFPMWMPEQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |