About (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine
(R)-cyclopropyl-(2,3-dimethylphenyl)methanamine (PubChem CID 55278882) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine.
Molecular Properties
| Compound Name | (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine |
| PubChem CID | 55278882 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine |
| SMILES | Cc1cccc([C@H](N)C2CC2)c1C |
| InChI | InChI=1S/C12H17N/c1-8-4-3-5-11(9(8)2)12(13)10-6-7-10/h3-5,10,12H,6-7,13H2,1-2H3/t12-/m1/s1 |
| InChIKey | QCHRBDNKQOSQQJ-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine?
The IUPAC name of (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine (CID 55278882) is (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine.
What is the SMILES notation for (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine?
The canonical SMILES for (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine is Cc1cccc([C@H](N)C2CC2)c1C.
What is the InChIKey of (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine?
The InChIKey is QCHRBDNKQOSQQJ-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H17N/c1-8-4-3-5-11(9(8)2)12(13)10-6-7-10/h3-5,10,12H,6-7,13H2,1-2H3/t12-/m1/s1.
What are the key properties of (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine?
(R)-cyclopropyl-(2,3-dimethylphenyl)methanamine has a molecular weight of 175.27 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-cyclopropyl-(2,3-dimethylphenyl)methanamine is sourced from PubChem (CID 55278882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).