About (1R)-1-phenylethanamine
(1R)-1-phenylethanamine (PubChem CID 643189) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is (1R)-1-phenylethanamine.
Molecular Properties
| Compound Name | (1R)-1-phenylethanamine |
| PubChem CID | 643189 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (1R)-1-phenylethanamine |
| SMILES | C[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3/t7-/m1/s1 |
| InChIKey | RQEUFEKYXDPUSK-SSDOTTSWSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-phenylethanamine?
The IUPAC name of (1R)-1-phenylethanamine (CID 643189) is (1R)-1-phenylethanamine.
What is the SMILES notation for (1R)-1-phenylethanamine?
The canonical SMILES for (1R)-1-phenylethanamine is C[C@@H](N)c1ccccc1.
What is the InChIKey of (1R)-1-phenylethanamine?
The InChIKey is RQEUFEKYXDPUSK-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3/t7-/m1/s1.
What are the key properties of (1R)-1-phenylethanamine?
(1R)-1-phenylethanamine has a molecular weight of 121.18 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-phenylethanamine is sourced from PubChem (CID 643189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).