C14H21NO — CID 171261811
(1S,2R)-2-amino-1-cyclobutyl-2-(2,3-dimethylphenyl)ethanol (PubChem CID 171261811) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclobutyl-2-(2,3-dimethylphenyl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclobutyl-2-(2,3-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 171261811 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclobutyl-2-(2,3-dimethylphenyl)ethanol |
| SMILES | Cc1cccc([C@@H](N)[C@@H](O)C2CCC2)c1C |
| InChI | InChI=1S/C14H21NO/c1-9-5-3-8-12(10(9)2)13(15)14(16)11-6-4-7-11/h3,5,8,11,13-14,16H,4,6-7,15H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | VVTLAZLKAIZXJC-KGLIPLIRSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |