C15H24ClNO2 — CID 171264654
2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-methylphenol;hydrochloride (PubChem CID 171264654) has the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171264654 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-methylphenol;hydrochloride |
| SMILES | Cc1cccc([C@@H](N)[C@@H](O)C2CCCCC2)c1O.Cl |
| InChI | InChI=1S/C15H23NO2.ClH/c1-10-6-5-9-12(14(10)17)13(16)15(18)11-7-3-2-4-8-11;/h5-6,9,11,13,15,17-18H,2-4,7-8,16H2,1H3;1H/t13-,15+;/m1./s1 |
| InChIKey | JNOLSGDDVLDQAH-PBCQUBLHSA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|