C14H21Cl2NO2 — CID 171268087
2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-chlorophenol;hydrochloride (PubChem CID 171268087) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-chlorophenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-chlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171268087 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-6-chlorophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccc(Cl)c1O)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H20ClNO2.ClH/c15-11-8-4-7-10(14(11)18)12(16)13(17)9-5-2-1-3-6-9;/h4,7-9,12-13,17-18H,1-3,5-6,16H2;1H/t12-,13+;/m0./s1 |
| InChIKey | UUDKWJGUCLKRGI-JHEYCYPBSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|