C14H19Cl4NO — CID 171270446
(1R,2S)-2-amino-1-cyclohexyl-2-(2,3,6-trichlorophenyl)ethanol;hydrochloride (PubChem CID 171270446) has the molecular formula C14H19Cl4NO and a molecular weight of 359.12 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclohexyl-2-(2,3,6-trichlorophenyl)ethanol;hydrochloride.
| Compound Name | (1R,2S)-2-amino-1-cyclohexyl-2-(2,3,6-trichlorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171270446 |
| Molecular Formula | C14H19Cl4NO |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclohexyl-2-(2,3,6-trichlorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(Cl)ccc(Cl)c1Cl)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H18Cl3NO.ClH/c15-9-6-7-10(16)12(17)11(9)13(18)14(19)8-4-2-1-3-5-8;/h6-8,13-14,19H,1-5,18H2;1H/t13-,14+;/m0./s1 |
| InChIKey | UTMRJEMQNXHDSV-LMRHVHIWSA-N |
| XLogP | 5.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|