C14H19Cl2NO — CID 171160225
(1S,2R)-2-amino-1-cyclohexyl-2-(3,5-dichlorophenyl)ethanol (PubChem CID 171160225) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclohexyl-2-(3,5-dichlorophenyl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclohexyl-2-(3,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 171160225 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclohexyl-2-(3,5-dichlorophenyl)ethanol |
| SMILES | N[C@H](c1cc(Cl)cc(Cl)c1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2NO/c15-11-6-10(7-12(16)8-11)13(17)14(18)9-4-2-1-3-5-9/h6-9,13-14,18H,1-5,17H2/t13-,14+/m1/s1 |
| InChIKey | MHYCSRBEAZYVMH-KGLIPLIRSA-N |
| XLogP | 3.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |