C14H20ClNO2 — CID 171261781
4-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-2-chlorophenol (PubChem CID 171261781) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-2-chlorophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-2-chlorophenol |
|---|---|
| PubChem CID | 171261781 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-2-chlorophenol |
| SMILES | N[C@H](c1ccc(O)c(Cl)c1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H20ClNO2/c15-11-8-10(6-7-12(11)17)13(16)14(18)9-4-2-1-3-5-9/h6-9,13-14,17-18H,1-5,16H2/t13-,14+/m1/s1 |
| InChIKey | NURRBMUHMRXXAK-KGLIPLIRSA-N |
| XLogP | 2.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |