C14H19BrClNO — CID 171267801
(1R,2S)-2-amino-2-(3-bromo-4-chlorophenyl)-1-cyclohexylethanol (PubChem CID 171267801) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(3-bromo-4-chlorophenyl)-1-cyclohexylethanol.
| Compound Name | (1R,2S)-2-amino-2-(3-bromo-4-chlorophenyl)-1-cyclohexylethanol |
|---|---|
| PubChem CID | 171267801 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (1R,2S)-2-amino-2-(3-bromo-4-chlorophenyl)-1-cyclohexylethanol |
| SMILES | N[C@@H](c1ccc(Cl)c(Br)c1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H19BrClNO/c15-11-8-10(6-7-12(11)16)13(17)14(18)9-4-2-1-3-5-9/h6-9,13-14,18H,1-5,17H2/t13-,14+/m0/s1 |
| InChIKey | CFUMUIDKXIKVFH-UONOGXRCSA-N |
| XLogP | 4.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |