C14H19Cl2NO2 — CID 171162019
2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4,6-dichlorophenol (PubChem CID 171162019) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4,6-dichlorophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 171162019 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4,6-dichlorophenol |
| SMILES | N[C@@H](c1cc(Cl)cc(Cl)c1O)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2NO2/c15-9-6-10(14(19)11(16)7-9)12(17)13(18)8-4-2-1-3-5-8/h6-8,12-13,18-19H,1-5,17H2/t12-,13+/m0/s1 |
| InChIKey | SKJNRVWUEQPZLX-QWHCGFSZSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|