C13H18ClNO2 — CID 171265596
2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-chloro-6-methylphenol (PubChem CID 171265596) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-chloro-6-methylphenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-chloro-6-methylphenol |
|---|---|
| PubChem CID | 171265596 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4-chloro-6-methylphenol |
| SMILES | Cc1cc(Cl)cc([C@@H](N)[C@@H](O)C2CCC2)c1O |
| InChI | InChI=1S/C13H18ClNO2/c1-7-5-9(14)6-10(12(7)16)11(15)13(17)8-3-2-4-8/h5-6,8,11,13,16-17H,2-4,15H2,1H3/t11-,13+/m1/s1 |
| InChIKey | DVDKUTSXLRDBOH-YPMHNXCESA-N |
| XLogP | 2.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|