C11H17Cl2NO2 — CID 171271266
2-[(1S,2R)-1-amino-2-hydroxybutyl]-4-chloro-6-methylphenol;hydrochloride (PubChem CID 171271266) has the molecular formula C11H17Cl2NO2 and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxybutyl]-4-chloro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxybutyl]-4-chloro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171271266 |
| Molecular Formula | C11H17Cl2NO2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxybutyl]-4-chloro-6-methylphenol;hydrochloride |
| SMILES | CC[C@@H](O)[C@@H](N)c1cc(Cl)cc(C)c1O.Cl |
| InChI | InChI=1S/C11H16ClNO2.ClH/c1-3-9(14)10(13)8-5-7(12)4-6(2)11(8)15;/h4-5,9-10,14-15H,3,13H2,1-2H3;1H/t9-,10+;/m1./s1 |
| InChIKey | MNEHNRXMRWOQCI-UXQCFNEQSA-N |
| XLogP | 2.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|