C10H15ClN2O — CID 130707571
(1S,2R)-1-amino-1-(2-amino-5-chlorophenyl)butan-2-ol (PubChem CID 130707571) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-amino-5-chlorophenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-amino-5-chlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 130707571 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-amino-5-chlorophenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C10H15ClN2O/c1-2-9(14)10(13)7-5-6(11)3-4-8(7)12/h3-5,9-10,14H,2,12-13H2,1H3/t9-,10+/m1/s1 |
| InChIKey | QSDWDSUUTGZRRL-ZJUUUORDSA-N |
| XLogP | 1.69 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|