C13H22Cl2N2O — CID 171265300
(1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-5-methylhexan-2-ol;hydrochloride (PubChem CID 171265300) has the molecular formula C13H22Cl2N2O and a molecular weight of 293.24 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-5-methylhexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-5-methylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171265300 |
| Molecular Formula | C13H22Cl2N2O |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-5-methylhexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1cc(Cl)ccc1N.Cl |
| InChI | InChI=1S/C13H21ClN2O.ClH/c1-8(2)3-6-12(17)13(16)10-7-9(14)4-5-11(10)15;/h4-5,7-8,12-13,17H,3,6,15-16H2,1-2H3;1H/t12-,13+;/m0./s1 |
| InChIKey | MKOXCKGUMUBIIJ-JHEYCYPBSA-N |
| XLogP | 3.14 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|