C12H19ClN2O — CID 171265293
(1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-3-methylpentan-2-ol (PubChem CID 171265293) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-3-methylpentan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 171265293 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-amino-5-chlorophenyl)-3-methylpentan-2-ol |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H19ClN2O/c1-3-7(2)12(16)11(15)9-6-8(13)4-5-10(9)14/h4-7,11-12,16H,3,14-15H2,1-2H3/t7?,11-,12+/m1/s1 |
| InChIKey | GVJBWMRTXXWOKI-BMVHATROSA-N |
| XLogP | 2.33 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|