C12H18ClN — CID 130804178
(1R)-1-(4-chloro-2-methylphenyl)-2-methylbutan-1-amine (PubChem CID 130804178) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is (1R)-1-(4-chloro-2-methylphenyl)-2-methylbutan-1-amine.
| Compound Name | (1R)-1-(4-chloro-2-methylphenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 130804178 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (1R)-1-(4-chloro-2-methylphenyl)-2-methylbutan-1-amine |
| SMILES | CCC(C)[C@@H](N)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H18ClN/c1-4-8(2)12(14)11-6-5-10(13)7-9(11)3/h5-8,12H,4,14H2,1-3H3/t8?,12-/m1/s1 |
| InChIKey | UUAZRNHUNPDOTF-LESKNEHBSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |