About 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide
4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide (PubChem CID 175483234) has the molecular formula C10H15ClO2
and a molecular weight of 202.68 g/mol. Its IUPAC name is 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide |
| PubChem CID | 175483234 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide |
| SMILES | Cc1cc(Cl)ccc1C(C)C.OO |
| InChI | InChI=1S/C10H13Cl.H2O2/c1-7(2)10-5-4-9(11)6-8(10)3;1-2/h4-7H,1-3H3;1-2H |
| InChIKey | VRQYOIPRXCSTLU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide?
The IUPAC name of 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide (CID 175483234) is 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide.
What is the SMILES notation for 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide?
The canonical SMILES for 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide is Cc1cc(Cl)ccc1C(C)C.OO.
What is the InChIKey of 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide?
The InChIKey is VRQYOIPRXCSTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.H2O2/c1-7(2)10-5-4-9(11)6-8(10)3;1-2/h4-7H,1-3H3;1-2H.
What are the key properties of 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide?
4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide has a molecular weight of 202.68 g/mol, XLogP of 3.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-1-propan-2-ylbenzene;hydrogen peroxide is sourced from PubChem (CID 175483234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).