C10H12Cl3NO — CID 131404134
(1S,2R)-1-amino-1-(2,3,5-trichlorophenyl)butan-2-ol (PubChem CID 131404134) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3,5-trichlorophenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,3,5-trichlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 131404134 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3,5-trichlorophenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl3NO/c1-2-8(15)10(14)6-3-5(11)4-7(12)9(6)13/h3-4,8,10,15H,2,14H2,1H3/t8-,10+/m1/s1 |
| InChIKey | YEZKYKIZVYHTCY-SCZZXKLOSA-N |
| XLogP | 3.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|