C9H10Cl3NO — CID 130060995
1-amino-1-(2,3,5-trichlorophenyl)propan-2-ol (PubChem CID 130060995) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is 1-amino-1-(2,3,5-trichlorophenyl)propan-2-ol.
| Compound Name | 1-amino-1-(2,3,5-trichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 130060995 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 1-amino-1-(2,3,5-trichlorophenyl)propan-2-ol |
| SMILES | CC(O)C(N)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl3NO/c1-4(14)9(13)6-2-5(10)3-7(11)8(6)12/h2-4,9,14H,13H2,1H3 |
| InChIKey | HXDYEOCHKAMLSQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|