C10H14ClNO — CID 130778314
(1R,2R)-1-amino-1-(5-chloro-2-methylphenyl)propan-2-ol (PubChem CID 130778314) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is (1R,2R)-1-amino-1-(5-chloro-2-methylphenyl)propan-2-ol.
| Compound Name | (1R,2R)-1-amino-1-(5-chloro-2-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 130778314 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1R,2R)-1-amino-1-(5-chloro-2-methylphenyl)propan-2-ol |
| SMILES | Cc1ccc(Cl)cc1[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C10H14ClNO/c1-6-3-4-8(11)5-9(6)10(12)7(2)13/h3-5,7,10,13H,12H2,1-2H3/t7-,10+/m1/s1 |
| InChIKey | LQQQRHAUAACIFI-XCBNKYQSSA-N |
| XLogP | 2.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |