C11H16ClNO — CID 130898767
(1R,2R)-2-amino-1-(5-chloro-2-methylphenyl)butan-1-ol (PubChem CID 130898767) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (1R,2R)-2-amino-1-(5-chloro-2-methylphenyl)butan-1-ol.
| Compound Name | (1R,2R)-2-amino-1-(5-chloro-2-methylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 130898767 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (1R,2R)-2-amino-1-(5-chloro-2-methylphenyl)butan-1-ol |
| SMILES | CC[C@@H](N)[C@H](O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C11H16ClNO/c1-3-10(13)11(14)9-6-8(12)5-4-7(9)2/h4-6,10-11,14H,3,13H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | RCDDMHZSZKVQTR-GHMZBOCLSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |