C10H13ClFNO — CID 130804035
2-amino-1-(2-chloro-3-fluorophenyl)butan-1-ol (PubChem CID 130804035) has the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-3-fluorophenyl)butan-1-ol.
| Compound Name | 2-amino-1-(2-chloro-3-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 130804035 |
| Molecular Formula | C10H13ClFNO |
| Molecular Weight | 217.67 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-amino-1-(2-chloro-3-fluorophenyl)butan-1-ol |
| SMILES | CCC(N)C(O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C10H13ClFNO/c1-2-8(13)10(14)6-4-3-5-7(12)9(6)11/h3-5,8,10,14H,2,13H2,1H3 |
| InChIKey | ITKWBYVHQZEERL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |