C9H12ClFN2 — CID 171222588
(1S)-1-(2-chloro-3-fluorophenyl)propane-1,3-diamine (PubChem CID 171222588) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3-fluorophenyl)propane-1,3-diamine.
| Compound Name | (1S)-1-(2-chloro-3-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 171222588 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (1S)-1-(2-chloro-3-fluorophenyl)propane-1,3-diamine |
| SMILES | NCC[C@H](N)c1cccc(F)c1Cl |
| InChI | InChI=1S/C9H12ClFN2/c10-9-6(8(13)4-5-12)2-1-3-7(9)11/h1-3,8H,4-5,12-13H2/t8-/m0/s1 |
| InChIKey | WLNRXCIIBKWPHE-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |