C10H12ClF3N2 — CID 171228970
(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 171228970) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is (1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,3-diamine.
| Compound Name | (1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 171228970 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | NCC[C@H](N)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H12ClF3N2/c11-9-6(8(16)4-5-15)2-1-3-7(9)10(12,13)14/h1-3,8H,4-5,15-16H2/t8-/m0/s1 |
| InChIKey | OBWMUTDUAJQYOV-QMMMGPOBSA-N |
| XLogP | 2.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |